C20H17O2+ — CID 101194037
4-(2-methoxyethenyl)-2,6-diphenylpyrylium (PubChem CID 101194037) has the molecular formula C20H17O2+ and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-(2-methoxyethenyl)-2,6-diphenylpyrylium.
| Compound Name | 4-(2-methoxyethenyl)-2,6-diphenylpyrylium |
|---|---|
| PubChem CID | 101194037 |
| Molecular Formula | C20H17O2+ |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 4-(2-methoxyethenyl)-2,6-diphenylpyrylium |
| SMILES | COC=Cc1cc(-c2ccccc2)[o+]c(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H17O2/c1-21-13-12-16-14-19(17-8-4-2-5-9-17)22-20(15-16)18-10-6-3-7-11-18/h2-15H,1H3/q+1 |
| InChIKey | ZQCHJFIKDTXZOH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|