C28H25BF4O2S — CID 21177733
4-[(E)-2-[4-(2-methylsulfanylethoxy)phenyl]ethenyl]-2,6-diphenylpyrylium tetrafluoroborate (PubChem CID 21177733) has the molecular formula C28H25BF4O2S and a molecular weight of 512.38 g/mol. Its IUPAC name is 4-[(E)-2-[4-(2-methylsulfanylethoxy)phenyl]ethenyl]-2,6-diphenylpyrylium tetrafluoroborate.
| Compound Name | 4-[(E)-2-[4-(2-methylsulfanylethoxy)phenyl]ethenyl]-2,6-diphenylpyrylium tetrafluoroborate |
|---|---|
| PubChem CID | 21177733 |
| Molecular Formula | C28H25BF4O2S |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 4-[(E)-2-[4-(2-methylsulfanylethoxy)phenyl]ethenyl]-2,6-diphenylpyrylium tetrafluoroborate |
| SMILES | CSCCOc1ccc(/C=C/c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C28H25O2S.BF4/c1-31-19-18-29-26-16-14-22(15-17-26)12-13-23-20-27(24-8-4-2-5-9-24)30-28(21-23)25-10-6-3-7-11-25;2-1(3,4)5/h2-17,20-21H,18-19H2,1H3;/q+1;-1/b13-12+; |
| InChIKey | ZKEGXPZKJOPJLT-UEIGIMKUSA-N |
| XLogP | 9.11 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|