C31H30FO3+ — CID 3092821
2-[2-(4-fluorophenyl)ethenyl]-4,6-bis(4-propoxyphenyl)pyrylium (PubChem CID 3092821) has the molecular formula C31H30FO3+ and a molecular weight of 469.58 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethenyl]-4,6-bis(4-propoxyphenyl)pyrylium.
| Compound Name | 2-[2-(4-fluorophenyl)ethenyl]-4,6-bis(4-propoxyphenyl)pyrylium |
|---|---|
| PubChem CID | 3092821 |
| Molecular Formula | C31H30FO3+ |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethenyl]-4,6-bis(4-propoxyphenyl)pyrylium |
| SMILES | CCCOc1ccc(-c2cc(C=Cc3ccc(F)cc3)[o+]c(-c3ccc(OCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C31H30FO3/c1-3-19-33-28-15-8-24(9-16-28)26-21-30(14-7-23-5-12-27(32)13-6-23)35-31(22-26)25-10-17-29(18-11-25)34-20-4-2/h5-18,21-22H,3-4,19-20H2,1-2H3/q+1 |
| InChIKey | RTMFGOJOAKVDMI-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|