C52H54F2N2O4 — CID 102320597
4-[4-amino-3-[6-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]hexoxy]phenyl]-2-[6-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]hexoxy]aniline (PubChem CID 102320597) has the molecular formula C52H54F2N2O4 and a molecular weight of 809.01 g/mol. Its IUPAC name is 4-[4-amino-3-[6-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]hexoxy]phenyl]-2-[6-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]hexoxy]aniline.
| Compound Name | 4-[4-amino-3-[6-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]hexoxy]phenyl]-2-[6-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]hexoxy]aniline |
|---|---|
| PubChem CID | 102320597 |
| Molecular Formula | C52H54F2N2O4 |
| Molecular Weight | 809.01 g/mol |
| Exact Mass | 808.41 |
| IUPAC Name | 4-[4-amino-3-[6-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]hexoxy]phenyl]-2-[6-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenoxy]hexoxy]aniline |
| SMILES | Nc1ccc(-c2ccc(N)c(OCCCCCCOc3ccc(/C=C/c4ccc(F)cc4)cc3)c2)cc1OCCCCCCOc1ccc(/C=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C52H54F2N2O4/c53-45-23-13-39(14-24-45)9-11-41-17-27-47(28-18-41)57-33-5-1-3-7-35-59-51-37-43(21-31-49(51)55)44-22-32-50(56)52(38-44)60-36-8-4-2-6-34-58-48-29-19-42(20-30-48)12-10-40-15-25-46(54)26-16-40/h9-32,37-38H,1-8,33-36,55-56H2/b11-9+,12-10+ |
| InChIKey | KEMZOUFATSKDHQ-WGDLNXRISA-N |
| XLogP | 13.17 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.01 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|