C26H21BF4O2 — CID 52987343
4-[(E)-2-(2-methoxyphenyl)ethenyl]-2,6-diphenylpyrylium tetrafluoroborate (PubChem CID 52987343) has the molecular formula C26H21BF4O2 and a molecular weight of 452.26 g/mol. Its IUPAC name is 4-[(E)-2-(2-methoxyphenyl)ethenyl]-2,6-diphenylpyrylium tetrafluoroborate.
| Compound Name | 4-[(E)-2-(2-methoxyphenyl)ethenyl]-2,6-diphenylpyrylium tetrafluoroborate |
|---|---|
| PubChem CID | 52987343 |
| Molecular Formula | C26H21BF4O2 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-[(E)-2-(2-methoxyphenyl)ethenyl]-2,6-diphenylpyrylium tetrafluoroborate |
| SMILES | COc1ccccc1/C=C/c1cc(-c2ccccc2)[o+]c(-c2ccccc2)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C26H21O2.BF4/c1-27-24-15-9-8-14-23(24)17-16-20-18-25(21-10-4-2-5-11-21)28-26(19-20)22-12-6-3-7-13-22;2-1(3,4)5/h2-19H,1H3;/q+1;-1/b17-16+; |
| InChIKey | YMIWFRHVVBIWQI-CMBBICFISA-N |
| XLogP | 8.37 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|