C25H26O2 — CID 145435822
2-ethyl-1,3-dimethoxy-5-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]benzene (PubChem CID 145435822) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-ethyl-1,3-dimethoxy-5-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]benzene.
| Compound Name | 2-ethyl-1,3-dimethoxy-5-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 145435822 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-ethyl-1,3-dimethoxy-5-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]benzene |
| SMILES | CCc1c(OC)cc(/C=C/c2cccc(-c3ccccc3)c2C)cc1OC |
| InChI | InChI=1S/C25H26O2/c1-5-22-24(26-3)16-19(17-25(22)27-4)14-15-20-12-9-13-23(18(20)2)21-10-7-6-8-11-21/h6-17H,5H2,1-4H3/b15-14+ |
| InChIKey | YIYIYLSVDKNQDN-CCEZHUSRSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|