C31H35NO3 — CID 170291055
1-[(2S)-1-[[2,5-dimethoxy-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-2-yl]ethanone (PubChem CID 170291055) has the molecular formula C31H35NO3 and a molecular weight of 469.63 g/mol. Its IUPAC name is 1-[(2S)-1-[[2,5-dimethoxy-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-2-yl]ethanone.
| Compound Name | 1-[(2S)-1-[[2,5-dimethoxy-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-2-yl]ethanone |
|---|---|
| PubChem CID | 170291055 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 1-[(2S)-1-[[2,5-dimethoxy-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-2-yl]ethanone |
| SMILES | COc1cc(CN2CCCC[C@H]2C(C)=O)c(OC)cc1/C=C/c1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C31H35NO3/c1-22-24(13-10-14-28(22)25-11-6-5-7-12-25)16-17-26-19-31(35-4)27(20-30(26)34-3)21-32-18-9-8-15-29(32)23(2)33/h5-7,10-14,16-17,19-20,29H,8-9,15,18,21H2,1-4H3/b17-16+/t29-/m0/s1 |
| InChIKey | VQCAPPSZROBEMQ-QSOMJGHASA-N |
| XLogP | 6.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|