C28H29NO5 — CID 177373868
(2S)-1-[[2-methoxy-4-(2-methyl-3-phenylbenzoyl)oxyphenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 177373868) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is (2S)-1-[[2-methoxy-4-(2-methyl-3-phenylbenzoyl)oxyphenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[2-methoxy-4-(2-methyl-3-phenylbenzoyl)oxyphenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 177373868 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (2S)-1-[[2-methoxy-4-(2-methyl-3-phenylbenzoyl)oxyphenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | COc1cc(OC(=O)c2cccc(-c3ccccc3)c2C)ccc1CN1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C28H29NO5/c1-19-23(20-9-4-3-5-10-20)11-8-12-24(19)28(32)34-22-15-14-21(26(17-22)33-2)18-29-16-7-6-13-25(29)27(30)31/h3-5,8-12,14-15,17,25H,6-7,13,16,18H2,1-2H3,(H,30,31)/t25-/m0/s1 |
| InChIKey | FCGXXHYWLZODFZ-VWLOTQADSA-N |
| XLogP | 5.33 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|