C29H27ClN2O3 — CID 175223553
1-[[5-chloro-4-[2-(2-cyano-3-phenylphenyl)ethenyl]-2-methoxyphenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 175223553) has the molecular formula C29H27ClN2O3 and a molecular weight of 487.00 g/mol. Its IUPAC name is 1-[[5-chloro-4-[2-(2-cyano-3-phenylphenyl)ethenyl]-2-methoxyphenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[[5-chloro-4-[2-(2-cyano-3-phenylphenyl)ethenyl]-2-methoxyphenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175223553 |
| Molecular Formula | C29H27ClN2O3 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 1-[[5-chloro-4-[2-(2-cyano-3-phenylphenyl)ethenyl]-2-methoxyphenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | COc1cc(C=Cc2cccc(-c3ccccc3)c2C#N)c(Cl)cc1CN1CCCCC1C(=O)O |
| InChI | InChI=1S/C29H27ClN2O3/c1-35-28-17-22(26(30)16-23(28)19-32-15-6-5-12-27(32)29(33)34)14-13-21-10-7-11-24(25(21)18-31)20-8-3-2-4-9-20/h2-4,7-11,13-14,16-17,27H,5-6,12,15,19H2,1H3,(H,33,34) |
| InChIKey | DLUHCNOPTRIJJK-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|