C28H26ClN3O2 — CID 167005248
(2S)-1-[[5-chloro-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-2-methylphenyl]methyl]piperazine-2-carboxylic acid (PubChem CID 167005248) has the molecular formula C28H26ClN3O2 and a molecular weight of 471.99 g/mol. Its IUPAC name is (2S)-1-[[5-chloro-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-2-methylphenyl]methyl]piperazine-2-carboxylic acid.
| Compound Name | (2S)-1-[[5-chloro-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-2-methylphenyl]methyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 167005248 |
| Molecular Formula | C28H26ClN3O2 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | (2S)-1-[[5-chloro-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-2-methylphenyl]methyl]piperazine-2-carboxylic acid |
| SMILES | Cc1cc(/C=C/c2cccc(-c3ccccc3)c2C#N)c(Cl)cc1CN1CCNC[C@H]1C(=O)O |
| InChI | InChI=1S/C28H26ClN3O2/c1-19-14-22(26(29)15-23(19)18-32-13-12-31-17-27(32)28(33)34)11-10-21-8-5-9-24(25(21)16-30)20-6-3-2-4-7-20/h2-11,14-15,27,31H,12-13,17-18H2,1H3,(H,33,34)/b11-10+/t27-/m0/s1 |
| InChIKey | BDIWSNFCBUITAA-GHUXWVSLSA-N |
| XLogP | 5.22 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|