C35H36N2O3 — CID 170291017
(2S)-1-[[4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-2-hex-5-ynoxy-5-methylphenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 170291017) has the molecular formula C35H36N2O3 and a molecular weight of 532.68 g/mol. Its IUPAC name is (2S)-1-[[4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-2-hex-5-ynoxy-5-methylphenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-2-hex-5-ynoxy-5-methylphenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 170291017 |
| Molecular Formula | C35H36N2O3 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | (2S)-1-[[4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-2-hex-5-ynoxy-5-methylphenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | C#CCCCCOc1cc(/C=C/c2cccc(-c3ccccc3)c2C#N)c(C)cc1CN1CCCC[C@H]1C(=O)O |
| InChI | InChI=1S/C35H36N2O3/c1-3-4-5-11-21-40-34-23-29(26(2)22-30(34)25-37-20-10-9-17-33(37)35(38)39)19-18-28-15-12-16-31(32(28)24-36)27-13-7-6-8-14-27/h1,6-8,12-16,18-19,22-23,33H,4-5,9-11,17,20-21,25H2,2H3,(H,38,39)/b19-18+/t33-/m0/s1 |
| InChIKey | YELZCCPMNGXHCV-IKAIBNPPSA-N |
| XLogP | 7.33 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|