C23H34N2O3 — CID 170291513
(2S)-1-[[5-tert-butyl-2-(4-cyanobutoxy)-4-methylphenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 170291513) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is (2S)-1-[[5-tert-butyl-2-(4-cyanobutoxy)-4-methylphenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[5-tert-butyl-2-(4-cyanobutoxy)-4-methylphenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 170291513 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (2S)-1-[[5-tert-butyl-2-(4-cyanobutoxy)-4-methylphenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cc(OCCCCC#N)c(CN2CCCC[C@H]2C(=O)O)cc1C(C)(C)C |
| InChI | InChI=1S/C23H34N2O3/c1-17-14-21(28-13-9-5-7-11-24)18(15-19(17)23(2,3)4)16-25-12-8-6-10-20(25)22(26)27/h14-15,20H,5-10,12-13,16H2,1-4H3,(H,26,27)/t20-/m0/s1 |
| InChIKey | MTIVFXGXXTYCLU-FQEVSTJZSA-N |
| XLogP | 4.80 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|