C34H35N3O3 — CID 167005548
(2S)-1-[[2-(4-cyanobutoxy)-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-5-methylphenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 167005548) has the molecular formula C34H35N3O3 and a molecular weight of 533.67 g/mol. Its IUPAC name is (2S)-1-[[2-(4-cyanobutoxy)-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-5-methylphenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[2-(4-cyanobutoxy)-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-5-methylphenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 167005548 |
| Molecular Formula | C34H35N3O3 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | (2S)-1-[[2-(4-cyanobutoxy)-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-5-methylphenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1cc(CN2CCCC[C@H]2C(=O)O)c(OCCCCC#N)cc1/C=C/c1cccc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C34H35N3O3/c1-25-21-29(24-37-19-8-6-15-32(37)34(38)39)33(40-20-9-3-7-18-35)22-28(25)17-16-27-13-10-14-30(31(27)23-36)26-11-4-2-5-12-26/h2,4-5,10-14,16-17,21-22,32H,3,6-9,15,19-20,24H2,1H3,(H,38,39)/b17-16+/t32-/m0/s1 |
| InChIKey | AUAUNIFEHADNSW-QMVZMEBMSA-N |
| XLogP | 7.22 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|