C36H37IN2O2 — CID 170291077
1-[(2S)-1-[[2-[(5-iodo-3-pyridinyl)methoxy]-5-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-2-yl]ethanone (PubChem CID 170291077) has the molecular formula C36H37IN2O2 and a molecular weight of 656.61 g/mol. Its IUPAC name is 1-[(2S)-1-[[2-[(5-iodo-3-pyridinyl)methoxy]-5-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-2-yl]ethanone.
| Compound Name | 1-[(2S)-1-[[2-[(5-iodo-3-pyridinyl)methoxy]-5-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-2-yl]ethanone |
|---|---|
| PubChem CID | 170291077 |
| Molecular Formula | C36H37IN2O2 |
| Molecular Weight | 656.61 g/mol |
| Exact Mass | 656.19 |
| IUPAC Name | 1-[(2S)-1-[[2-[(5-iodo-3-pyridinyl)methoxy]-5-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CCCCN1Cc1cc(C)c(/C=C/c2cccc(-c3ccccc3)c2C)cc1OCc1cncc(I)c1 |
| InChI | InChI=1S/C36H37IN2O2/c1-25-18-32(23-39-17-8-7-14-35(39)27(3)40)36(41-24-28-19-33(37)22-38-21-28)20-31(25)16-15-29-12-9-13-34(26(29)2)30-10-5-4-6-11-30/h4-6,9-13,15-16,18-22,35H,7-8,14,17,23-24H2,1-3H3/b16-15+/t35-/m0/s1 |
| InChIKey | MNXUSLRLUDFPOW-CJVYAQSVSA-N |
| XLogP | 8.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.61 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|