C33H33N3O4 — CID 167005550
(3S)-4-[[2-(4-cyanobutoxy)-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-5-methylphenyl]methyl]morpholine-3-carboxylic acid (PubChem CID 167005550) has the molecular formula C33H33N3O4 and a molecular weight of 535.64 g/mol. Its IUPAC name is (3S)-4-[[2-(4-cyanobutoxy)-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-5-methylphenyl]methyl]morpholine-3-carboxylic acid.
| Compound Name | (3S)-4-[[2-(4-cyanobutoxy)-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-5-methylphenyl]methyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 167005550 |
| Molecular Formula | C33H33N3O4 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | (3S)-4-[[2-(4-cyanobutoxy)-4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-5-methylphenyl]methyl]morpholine-3-carboxylic acid |
| SMILES | Cc1cc(CN2CCOC[C@H]2C(=O)O)c(OCCCCC#N)cc1/C=C/c1cccc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C33H33N3O4/c1-24-19-28(22-36-16-18-39-23-31(36)33(37)38)32(40-17-7-3-6-15-34)20-27(24)14-13-26-11-8-12-29(30(26)21-35)25-9-4-2-5-10-25/h2,4-5,8-14,19-20,31H,3,6-7,16-18,22-23H2,1H3,(H,37,38)/b14-13+/t31-/m0/s1 |
| InChIKey | BNELSXAYTLHUFN-WQEHWUEJSA-N |
| XLogP | 6.06 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|