C28H28N2O — CID 167005433
2-[(E)-2-[5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)phenyl]ethenyl]-6-phenylbenzonitrile (PubChem CID 167005433) has the molecular formula C28H28N2O and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[(E)-2-[5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)phenyl]ethenyl]-6-phenylbenzonitrile.
| Compound Name | 2-[(E)-2-[5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)phenyl]ethenyl]-6-phenylbenzonitrile |
|---|---|
| PubChem CID | 167005433 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[(E)-2-[5-hydroxy-2-methyl-4-(piperidin-1-ylmethyl)phenyl]ethenyl]-6-phenylbenzonitrile |
| SMILES | Cc1cc(CN2CCCCC2)c(O)cc1/C=C/c1cccc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C28H28N2O/c1-21-17-25(20-30-15-6-3-7-16-30)28(31)18-24(21)14-13-23-11-8-12-26(27(23)19-29)22-9-4-2-5-10-22/h2,4-5,8-14,17-18,31H,3,6-7,15-16,20H2,1H3/b14-13+ |
| InChIKey | OXCMOYOHYFYUAX-BUHFOSPRSA-N |
| XLogP | 6.40 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|