C29H27F3N2O — CID 170028335
2-[(E)-2-[5-(hydroxymethyl)-4-(piperidin-1-ylmethyl)-2-(trifluoromethyl)phenyl]ethenyl]-6-phenylbenzonitrile (PubChem CID 170028335) has the molecular formula C29H27F3N2O and a molecular weight of 476.54 g/mol. Its IUPAC name is 2-[(E)-2-[5-(hydroxymethyl)-4-(piperidin-1-ylmethyl)-2-(trifluoromethyl)phenyl]ethenyl]-6-phenylbenzonitrile.
| Compound Name | 2-[(E)-2-[5-(hydroxymethyl)-4-(piperidin-1-ylmethyl)-2-(trifluoromethyl)phenyl]ethenyl]-6-phenylbenzonitrile |
|---|---|
| PubChem CID | 170028335 |
| Molecular Formula | C29H27F3N2O |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-[(E)-2-[5-(hydroxymethyl)-4-(piperidin-1-ylmethyl)-2-(trifluoromethyl)phenyl]ethenyl]-6-phenylbenzonitrile |
| SMILES | N#Cc1c(/C=C/c2cc(CO)c(CN3CCCCC3)cc2C(F)(F)F)cccc1-c1ccccc1 |
| InChI | InChI=1S/C29H27F3N2O/c30-29(31,32)28-17-24(19-34-14-5-2-6-15-34)25(20-35)16-23(28)13-12-22-10-7-11-26(27(22)18-33)21-8-3-1-4-9-21/h1,3-4,7-13,16-17,35H,2,5-6,14-15,19-20H2/b13-12+ |
| InChIKey | YEAMJDPWWSMDDS-OUKQBFOZSA-N |
| XLogP | 6.89 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|