C33H38F3N — CID 170026935
1-[[4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-2-pentyl-5-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 170026935) has the molecular formula C33H38F3N and a molecular weight of 505.67 g/mol. Its IUPAC name is 1-[[4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-2-pentyl-5-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 1-[[4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-2-pentyl-5-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 170026935 |
| Molecular Formula | C33H38F3N |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | 1-[[4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-2-pentyl-5-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | CCCCCc1cc(/C=C/c2cccc(-c3ccccc3)c2C)c(C(F)(F)F)cc1CN1CCCCC1 |
| InChI | InChI=1S/C33H38F3N/c1-3-4-7-15-28-22-29(32(33(34,35)36)23-30(28)24-37-20-10-6-11-21-37)19-18-26-16-12-17-31(25(26)2)27-13-8-5-9-14-27/h5,8-9,12-14,16-19,22-23H,3-4,6-7,10-11,15,20-21,24H2,1-2H3/b19-18+ |
| InChIKey | SRNNZGVMBNARBX-VHEBQXMUSA-N |
| XLogP | 9.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|