C23H18ClF3O2 — CID 167005642
chloro-[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methanediol (PubChem CID 167005642) has the molecular formula C23H18ClF3O2 and a molecular weight of 418.84 g/mol. Its IUPAC name is chloro-[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methanediol.
| Compound Name | chloro-[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methanediol |
|---|---|
| PubChem CID | 167005642 |
| Molecular Formula | C23H18ClF3O2 |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | chloro-[3-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]-4-(trifluoromethyl)phenyl]methanediol |
| SMILES | Cc1c(/C=C/c2cc(C(O)(O)Cl)ccc2C(F)(F)F)cccc1-c1ccccc1 |
| InChI | InChI=1S/C23H18ClF3O2/c1-15-16(8-5-9-20(15)17-6-3-2-4-7-17)10-11-18-14-19(22(24,28)29)12-13-21(18)23(25,26)27/h2-14,28-29H,1H3/b11-10+ |
| InChIKey | AZFABLLCZCLFME-ZHACJKMWSA-N |
| XLogP | 6.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|