C20H28N2O — CID 170027987
2-[1-[(4,5-dimethyl-2-propoxyphenyl)methyl]piperidin-2-yl]prop-2-enenitrile (PubChem CID 170027987) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 2-[1-[(4,5-dimethyl-2-propoxyphenyl)methyl]piperidin-2-yl]prop-2-enenitrile.
| Compound Name | 2-[1-[(4,5-dimethyl-2-propoxyphenyl)methyl]piperidin-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 170027987 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 2-[1-[(4,5-dimethyl-2-propoxyphenyl)methyl]piperidin-2-yl]prop-2-enenitrile |
| SMILES | C=C(C#N)C1CCCCN1Cc1cc(C)c(C)cc1OCCC |
| InChI | InChI=1S/C20H28N2O/c1-5-10-23-20-12-16(3)15(2)11-18(20)14-22-9-7-6-8-19(22)17(4)13-21/h11-12,19H,4-10,14H2,1-3H3 |
| InChIKey | OODPEQUJIRSPHO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|