C31H28N2O2 — CID 170293069
2-[(E)-2-[2-[(2-formylpiperidin-1-yl)methyl]-5-prop-2-ynoxyphenyl]ethenyl]-6-phenylbenzonitrile (PubChem CID 170293069) has the molecular formula C31H28N2O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-[(E)-2-[2-[(2-formylpiperidin-1-yl)methyl]-5-prop-2-ynoxyphenyl]ethenyl]-6-phenylbenzonitrile.
| Compound Name | 2-[(E)-2-[2-[(2-formylpiperidin-1-yl)methyl]-5-prop-2-ynoxyphenyl]ethenyl]-6-phenylbenzonitrile |
|---|---|
| PubChem CID | 170293069 |
| Molecular Formula | C31H28N2O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 2-[(E)-2-[2-[(2-formylpiperidin-1-yl)methyl]-5-prop-2-ynoxyphenyl]ethenyl]-6-phenylbenzonitrile |
| SMILES | C#CCOc1ccc(CN2CCCCC2C=O)c(/C=C/c2cccc(-c3ccccc3)c2C#N)c1 |
| InChI | InChI=1S/C31H28N2O2/c1-2-19-35-29-17-16-27(22-33-18-7-6-12-28(33)23-34)26(20-29)15-14-25-11-8-13-30(31(25)21-32)24-9-4-3-5-10-24/h1,3-5,8-11,13-17,20,23,28H,6-7,12,18-19,22H2/b15-14+ |
| InChIKey | UVPKYTIXTLGLDJ-CCEZHUSRSA-N |
| XLogP | 5.96 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|