C29H30N2O3 — CID 139558176
2-[2-[4-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-3,5-dimethoxyphenyl]ethenyl]-6-phenylbenzonitrile (PubChem CID 139558176) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[2-[4-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-3,5-dimethoxyphenyl]ethenyl]-6-phenylbenzonitrile.
| Compound Name | 2-[2-[4-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-3,5-dimethoxyphenyl]ethenyl]-6-phenylbenzonitrile |
|---|---|
| PubChem CID | 139558176 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[2-[4-[[2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-3,5-dimethoxyphenyl]ethenyl]-6-phenylbenzonitrile |
| SMILES | COc1cc(C=Cc2cccc(-c3ccccc3)c2C#N)cc(OC)c1CN1CCCC1CO |
| InChI | InChI=1S/C29H30N2O3/c1-33-28-16-21(17-29(34-2)27(28)19-31-15-7-11-24(31)20-32)13-14-23-10-6-12-25(26(23)18-30)22-8-4-3-5-9-22/h3-6,8-10,12-14,16-17,24,32H,7,11,15,19-20H2,1-2H3 |
| InChIKey | NPOXTABWEBJZQZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|