C29H30ClNO2 — CID 170291025
1-[(3S)-4-[[5-chloro-2-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]morpholin-3-yl]ethenol (PubChem CID 170291025) has the molecular formula C29H30ClNO2 and a molecular weight of 460.02 g/mol. Its IUPAC name is 1-[(3S)-4-[[5-chloro-2-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]morpholin-3-yl]ethenol.
| Compound Name | 1-[(3S)-4-[[5-chloro-2-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]morpholin-3-yl]ethenol |
|---|---|
| PubChem CID | 170291025 |
| Molecular Formula | C29H30ClNO2 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 1-[(3S)-4-[[5-chloro-2-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]morpholin-3-yl]ethenol |
| SMILES | C=C(O)[C@@H]1COCCN1Cc1cc(Cl)c(/C=C/c2cccc(-c3ccccc3)c2C)cc1C |
| InChI | InChI=1S/C29H30ClNO2/c1-20-16-25(28(30)17-26(20)18-31-14-15-33-19-29(31)22(3)32)13-12-23-10-7-11-27(21(23)2)24-8-5-4-6-9-24/h4-13,16-17,29,32H,3,14-15,18-19H2,1-2H3/b13-12+/t29-/m0/s1 |
| InChIKey | CQMGGWKROWBBMB-SYJLOCQFSA-N |
| XLogP | 7.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|