C28H30ClNO2 — CID 138606858
1-[[3-chloro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]-2-(hydroxymethyl)piperidin-3-ol (PubChem CID 138606858) has the molecular formula C28H30ClNO2 and a molecular weight of 448.01 g/mol. Its IUPAC name is 1-[[3-chloro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]-2-(hydroxymethyl)piperidin-3-ol.
| Compound Name | 1-[[3-chloro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]-2-(hydroxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 138606858 |
| Molecular Formula | C28H30ClNO2 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-[[3-chloro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]-2-(hydroxymethyl)piperidin-3-ol |
| SMILES | Cc1c(/C=C/c2ccc(CN3CCCC(O)C3CO)cc2Cl)cccc1-c1ccccc1 |
| InChI | InChI=1S/C28H30ClNO2/c1-20-22(9-5-10-25(20)23-7-3-2-4-8-23)14-15-24-13-12-21(17-26(24)29)18-30-16-6-11-28(32)27(30)19-31/h2-5,7-10,12-15,17,27-28,31-32H,6,11,16,18-19H2,1H3/b15-14+ |
| InChIKey | IRVPUUGDNXDUNC-CCEZHUSRSA-N |
| XLogP | 5.80 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|