C29H33NO2 — CID 138606859
2-(hydroxymethyl)-1-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-3-ol (PubChem CID 138606859) has the molecular formula C29H33NO2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-3-ol.
| Compound Name | 2-(hydroxymethyl)-1-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 138606859 |
| Molecular Formula | C29H33NO2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-(hydroxymethyl)-1-[[3-methyl-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]piperidin-3-ol |
| SMILES | Cc1cc(CN2CCCC(O)C2CO)ccc1/C=C/c1cccc(-c2ccccc2)c1C |
| InChI | InChI=1S/C29H33NO2/c1-21-18-23(19-30-17-7-12-29(32)28(30)20-31)13-14-24(21)15-16-25-10-6-11-27(22(25)2)26-8-4-3-5-9-26/h3-6,8-11,13-16,18,28-29,31-32H,7,12,17,19-20H2,1-2H3/b16-15+ |
| InChIKey | JWVXJEHCLYLWKY-FOCLMDBBSA-N |
| XLogP | 5.46 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|