C28H28FNO3 — CID 138606842
1-[[3-fluoro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]-3-hydroxypiperidine-2-carboxylic acid (PubChem CID 138606842) has the molecular formula C28H28FNO3 and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-[[3-fluoro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]-3-hydroxypiperidine-2-carboxylic acid.
| Compound Name | 1-[[3-fluoro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]-3-hydroxypiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 138606842 |
| Molecular Formula | C28H28FNO3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[[3-fluoro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methyl]-3-hydroxypiperidine-2-carboxylic acid |
| SMILES | Cc1c(/C=C/c2ccc(CN3CCCC(O)C3C(=O)O)cc2F)cccc1-c1ccccc1 |
| InChI | InChI=1S/C28H28FNO3/c1-19-21(9-5-10-24(19)22-7-3-2-4-8-22)14-15-23-13-12-20(17-25(23)29)18-30-16-6-11-26(31)27(30)28(32)33/h2-5,7-10,12-15,17,26-27,31H,6,11,16,18H2,1H3,(H,32,33)/b15-14+ |
| InChIKey | DBVGBMSXZRLIBX-CCEZHUSRSA-N |
| XLogP | 5.38 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|