C29H25F3N2O2 — CID 167005557
(2S)-1-[[4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-3-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 167005557) has the molecular formula C29H25F3N2O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is (2S)-1-[[4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-3-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-3-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 167005557 |
| Molecular Formula | C29H25F3N2O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (2S)-1-[[4-[(E)-2-(2-cyano-3-phenylphenyl)ethenyl]-3-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | N#Cc1c(/C=C/c2ccc(CN3CCCC[C@H]3C(=O)O)cc2C(F)(F)F)cccc1-c1ccccc1 |
| InChI | InChI=1S/C29H25F3N2O2/c30-29(31,32)26-17-20(19-34-16-5-4-11-27(34)28(35)36)12-13-23(26)15-14-22-9-6-10-24(25(22)18-33)21-7-2-1-3-8-21/h1-3,6-10,12-15,17,27H,4-5,11,16,19H2,(H,35,36)/b15-14+/t27-/m0/s1 |
| InChIKey | PAAUGUKJKPMTRF-RTHBMQBDSA-N |
| XLogP | 6.85 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|