C19H21NO — CID 2845380
1-(9H-fluoren-2-ylmethyl)piperidin-3-ol (PubChem CID 2845380) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(9H-fluoren-2-ylmethyl)piperidin-3-ol.
| Compound Name | 1-(9H-fluoren-2-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 2845380 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 1-(9H-fluoren-2-ylmethyl)piperidin-3-ol |
| SMILES | OC1CCCN(Cc2ccc3c(c2)Cc2ccccc2-3)C1 |
| InChI | InChI=1S/C19H21NO/c21-17-5-3-9-20(13-17)12-14-7-8-19-16(10-14)11-15-4-1-2-6-18(15)19/h1-2,4,6-8,10,17,21H,3,5,9,11-13H2 |
| InChIKey | UTOJXLPIFGHWPZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |