C25H26ClNO2 — CID 138632873
2-[[3-chloro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propane-1,3-diol (PubChem CID 138632873) has the molecular formula C25H26ClNO2 and a molecular weight of 407.94 g/mol. Its IUPAC name is 2-[[3-chloro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propane-1,3-diol.
| Compound Name | 2-[[3-chloro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 138632873 |
| Molecular Formula | C25H26ClNO2 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[[3-chloro-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]propane-1,3-diol |
| SMILES | Cc1c(/C=C/c2ccc(CNC(CO)CO)cc2Cl)cccc1-c1ccccc1 |
| InChI | InChI=1S/C25H26ClNO2/c1-18-20(8-5-9-24(18)21-6-3-2-4-7-21)12-13-22-11-10-19(14-25(22)26)15-27-23(16-28)17-29/h2-14,23,27-29H,15-17H2,1H3/b13-12+ |
| InChIKey | YDPBUABIURQKRA-OUKQBFOZSA-N |
| XLogP | 4.93 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|