C28H31NO5 — CID 139558242
2-[[2,6-dimethoxy-4-[2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]-4-hydroxybutanoic acid (PubChem CID 139558242) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-[[2,6-dimethoxy-4-[2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[2,6-dimethoxy-4-[2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 139558242 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 2-[[2,6-dimethoxy-4-[2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]-4-hydroxybutanoic acid |
| SMILES | COc1cc(C=Cc2cccc(-c3ccccc3)c2C)cc(OC)c1CNC(CCO)C(=O)O |
| InChI | InChI=1S/C28H31NO5/c1-19-21(10-7-11-23(19)22-8-5-4-6-9-22)13-12-20-16-26(33-2)24(27(17-20)34-3)18-29-25(14-15-30)28(31)32/h4-13,16-17,25,29-30H,14-15,18H2,1-3H3,(H,31,32) |
| InChIKey | GROLNZCAGMUWFZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|