C26H25NO3 — CID 158892469
4-[3-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]-2-methylphenyl]benzamide (PubChem CID 158892469) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is 4-[3-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]-2-methylphenyl]benzamide.
| Compound Name | 4-[3-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 158892469 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 4-[3-[(E)-2-(4-ethenyl-3,5-dimethoxyphenyl)ethenyl]-2-methylphenyl]benzamide |
| SMILES | C=Cc1c(OC)cc(/C=C/c2cccc(-c3ccc(C(N)=O)cc3)c2C)cc1OC |
| InChI | InChI=1S/C26H25NO3/c1-5-22-24(29-3)15-18(16-25(22)30-4)9-10-19-7-6-8-23(17(19)2)20-11-13-21(14-12-20)26(27)28/h5-16H,1H2,2-4H3,(H2,27,28)/b10-9+ |
| InChIKey | FOIOGGJKDBEZEA-MDZDMXLPSA-N |
| XLogP | 5.59 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|