C31H29NO5 — CID 138606847
2-[[2,6-dimethoxy-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]-6-hydroxybenzoic acid (PubChem CID 138606847) has the molecular formula C31H29NO5 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[[2,6-dimethoxy-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]-6-hydroxybenzoic acid.
| Compound Name | 2-[[2,6-dimethoxy-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 138606847 |
| Molecular Formula | C31H29NO5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 2-[[2,6-dimethoxy-4-[(E)-2-(2-methyl-3-phenylphenyl)ethenyl]phenyl]methylamino]-6-hydroxybenzoic acid |
| SMILES | COc1cc(/C=C/c2cccc(-c3ccccc3)c2C)cc(OC)c1CNc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C31H29NO5/c1-20-22(11-7-12-24(20)23-9-5-4-6-10-23)16-15-21-17-28(36-2)25(29(18-21)37-3)19-32-26-13-8-14-27(33)30(26)31(34)35/h4-18,32-33H,19H2,1-3H3,(H,34,35)/b16-15+ |
| InChIKey | OTWSEWCJCVZLCO-FOCLMDBBSA-N |
| XLogP | 6.87 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|