C36H34O3P+ — CID 44589590
4-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium (PubChem CID 44589590) has the molecular formula C36H34O3P+ and a molecular weight of 545.64 g/mol. Its IUPAC name is 4-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium.
| Compound Name | 4-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium |
|---|---|
| PubChem CID | 44589590 |
| Molecular Formula | C36H34O3P+ |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 4-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium |
| SMILES | Oc1cc(O)cc(/C=C/c2ccc(OCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C36H33O3P/c37-31-26-30(27-32(38)28-31)19-18-29-20-22-33(23-21-29)39-24-10-11-25-40(34-12-4-1-5-13-34,35-14-6-2-7-15-35)36-16-8-3-9-17-36/h1-9,12-23,26-28H,10-11,24-25H2,(H-,37,38)/p+1/b19-18+ |
| InChIKey | VLWYDTAYPRAXCP-VHEBQXMUSA-O |
| XLogP | 7.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|