2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid

C16H14O5 — CID 75052814

IUPAC2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid
SMILESO=C(O)COc1ccc(C=Cc2cc(O)cc(O)c2)cc1
InChIInChI=1S/C16H14O5/c17-13-7-12(8-14(18)9-13)2-1-11-3-5-15(6-4-11)21-10-16(19)20/h1-9,17-18H,10H2,(H,19,20)
InChIKeyINVXNRJFCIBXGV-UHFFFAOYSA-N
MW286.28 g/mol
LogP2.73
Rot. Bonds5

About 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid

2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid (PubChem CID 75052814) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid.

Molecular Properties

Compound Name2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid
PubChem CID75052814
Molecular FormulaC16H14O5
Molecular Weight286.28 g/mol
Exact Mass286.08
IUPAC Name2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid
SMILESO=C(O)COc1ccc(C=Cc2cc(O)cc(O)c2)cc1
InChIInChI=1S/C16H14O5/c17-13-7-12(8-14(18)9-13)2-1-11-3-5-15(6-4-11)21-10-16(19)20/h1-9,17-18H,10H2,(H,19,20)
InChIKeyINVXNRJFCIBXGV-UHFFFAOYSA-N
XLogP2.73
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.28
LogP ≤ 52.73
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid?
The IUPAC name of 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid (CID 75052814) is 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid.
What is the SMILES notation for 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid?
The canonical SMILES for 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid is O=C(O)COc1ccc(C=Cc2cc(O)cc(O)c2)cc1.
What is the InChIKey of 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid?
The InChIKey is INVXNRJFCIBXGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O5/c17-13-7-12(8-14(18)9-13)2-1-11-3-5-15(6-4-11)21-10-16(19)20/h1-9,17-18H,10H2,(H,19,20).
What are the key properties of 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid?
2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid has a molecular weight of 286.28 g/mol, XLogP of 2.73, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]acetic acid is sourced from PubChem (CID 75052814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).