C11H11NO4 — CID 170876536
2-[4-[(E)-3-amino-3-oxoprop-1-enyl]phenoxy]acetic acid (PubChem CID 170876536) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-[4-[(E)-3-amino-3-oxoprop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-3-amino-3-oxoprop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 170876536 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-[4-[(E)-3-amino-3-oxoprop-1-enyl]phenoxy]acetic acid |
| SMILES | NC(=O)/C=C/c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C11H11NO4/c12-10(13)6-3-8-1-4-9(5-2-8)16-7-11(14)15/h1-6H,7H2,(H2,12,13)(H,14,15)/b6-3+ |
| InChIKey | DCUPMXJLGGSECN-ZZXKWVIFSA-N |
| XLogP | 0.65 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|