C40H31N2O+ — CID 4917768
2-[4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium (PubChem CID 4917768) has the molecular formula C40H31N2O+ and a molecular weight of 555.70 g/mol. Its IUPAC name is 2-[4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium.
| Compound Name | 2-[4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium |
|---|---|
| PubChem CID | 4917768 |
| Molecular Formula | C40H31N2O+ |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 2-[4-[2-(2,6-diphenylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium |
| SMILES | C1=CC(=[N+]2N=C(c3ccccc3)CC2c2ccccc2)C=CC1=CC=C1C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C40H31N2O/c1-5-13-32(14-6-1)37-29-38(33-15-7-2-8-16-33)42(41-37)36-25-23-30(24-26-36)21-22-31-27-39(34-17-9-3-10-18-34)43-40(28-31)35-19-11-4-12-20-35/h1-28,38H,29H2/q+1/b30-21-,42-36- |
| InChIKey | DFYONKPXJNAINF-AUSZDIJISA-N |
| XLogP | 9.08 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|