C16H15NO — CID 177458650
4,6-diphenyl-5,6-dihydro-2H-1,3-oxazine (PubChem CID 177458650) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 4,6-diphenyl-5,6-dihydro-2H-1,3-oxazine.
| Compound Name | 4,6-diphenyl-5,6-dihydro-2H-1,3-oxazine |
|---|---|
| PubChem CID | 177458650 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 4,6-diphenyl-5,6-dihydro-2H-1,3-oxazine |
| SMILES | c1ccc(C2=NCOC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C16H15NO/c1-3-7-13(8-4-1)15-11-16(18-12-17-15)14-9-5-2-6-10-14/h1-10,16H,11-12H2 |
| InChIKey | QAWSYSDTTBMBSD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |