C22H19NO — CID 122224215
(5R,6S)-2,5,6-triphenyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 122224215) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is (5R,6S)-2,5,6-triphenyl-5,6-dihydro-4H-1,3-oxazine.
| Compound Name | (5R,6S)-2,5,6-triphenyl-5,6-dihydro-4H-1,3-oxazine |
|---|---|
| PubChem CID | 122224215 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (5R,6S)-2,5,6-triphenyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | c1ccc(C2=NC[C@@H](c3ccccc3)[C@@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C22H19NO/c1-4-10-17(11-5-1)20-16-23-22(19-14-8-3-9-15-19)24-21(20)18-12-6-2-7-13-18/h1-15,20-21H,16H2/t20-,21+/m0/s1 |
| InChIKey | CVUYMLVBLRCUNG-LEWJYISDSA-N |
| XLogP | 4.99 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |