About 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol
2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol (PubChem CID 173312747) has the molecular formula C15H12FNO2
and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol |
| PubChem CID | 173312747 |
| Molecular Formula | C15H12FNO2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol |
| SMILES | Oc1cc(C2=NC[C@@H](c3ccccc3)O2)ccc1F |
| InChI | InChI=1S/C15H12FNO2/c16-12-7-6-11(8-13(12)18)15-17-9-14(19-15)10-4-2-1-3-5-10/h1-8,14,18H,9H2/t14-/m0/s1 |
| InChIKey | AALNPOVBNQZEGU-AWEZNQCLSA-N |
| XLogP | 3.05 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol?
The IUPAC name of 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol (CID 173312747) is 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol.
What is the SMILES notation for 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol?
The canonical SMILES for 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol is Oc1cc(C2=NC[C@@H](c3ccccc3)O2)ccc1F.
What is the InChIKey of 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol?
The InChIKey is AALNPOVBNQZEGU-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H12FNO2/c16-12-7-6-11(8-13(12)18)15-17-9-14(19-15)10-4-2-1-3-5-10/h1-8,14,18H,9H2/t14-/m0/s1.
What are the key properties of 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol?
2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol has a molecular weight of 257.26 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol is sourced from PubChem (CID 173312747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).