C15H12FNO2 — CID 173312747
2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol (PubChem CID 173312747) has the molecular formula C15H12FNO2 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol.
| Compound Name | 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol |
|---|---|
| PubChem CID | 173312747 |
| Molecular Formula | C15H12FNO2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 2-fluoro-5-[(5R)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]phenol |
| SMILES | Oc1cc(C2=NC[C@@H](c3ccccc3)O2)ccc1F |
| InChI | InChI=1S/C15H12FNO2/c16-12-7-6-11(8-13(12)18)15-17-9-14(19-15)10-4-2-1-3-5-10/h1-8,14,18H,9H2/t14-/m0/s1 |
| InChIKey | AALNPOVBNQZEGU-AWEZNQCLSA-N |
| XLogP | 3.05 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |