C38H29N2S+ — CID 98157751
(3R)-2-[4-(2,6-diphenylthiopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium (PubChem CID 98157751) has the molecular formula C38H29N2S+ and a molecular weight of 545.73 g/mol. Its IUPAC name is (3R)-2-[4-(2,6-diphenylthiopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium.
| Compound Name | (3R)-2-[4-(2,6-diphenylthiopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium |
|---|---|
| PubChem CID | 98157751 |
| Molecular Formula | C38H29N2S+ |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (3R)-2-[4-(2,6-diphenylthiopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-3,5-diphenyl-3,4-dihydropyrazol-2-ium |
| SMILES | C1=CC(=[N+]2N=C(c3ccccc3)C[C@@H]2c2ccccc2)C=CC1=C1C=C(c2ccccc2)SC(c2ccccc2)=C1 |
| InChI | InChI=1S/C38H29N2S/c1-5-13-29(14-6-1)35-27-36(30-15-7-2-8-16-30)40(39-35)34-23-21-28(22-24-34)33-25-37(31-17-9-3-10-18-31)41-38(26-33)32-19-11-4-12-20-32/h1-26,36H,27H2/q+1/t36-/m1/s1 |
| InChIKey | DXKHJOKJLZIZJB-PSXMRANNSA-N |
| XLogP | 9.24 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|