C26H34N4O7S — CID 149027720
amino 3-[(2Z)-2-[(E)-4-(1,3-dibutyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)but-2-enylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonate (PubChem CID 149027720) has the molecular formula C26H34N4O7S and a molecular weight of 546.65 g/mol. Its IUPAC name is amino 3-[(2Z)-2-[(E)-4-(1,3-dibutyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)but-2-enylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonate.
| Compound Name | amino 3-[(2Z)-2-[(E)-4-(1,3-dibutyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)but-2-enylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 149027720 |
| Molecular Formula | C26H34N4O7S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | amino 3-[(2Z)-2-[(E)-4-(1,3-dibutyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)but-2-enylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonate |
| SMILES | CCCCN1C(=O)C(=C/C=C/C=C2\Oc3ccccc3N2CCCS(=O)(=O)ON)C(=O)N(CCCC)C1=O |
| InChI | InChI=1S/C26H34N4O7S/c1-3-5-16-29-24(31)20(25(32)30(26(29)33)17-6-4-2)12-7-10-15-23-28(18-11-19-38(34,35)37-27)21-13-8-9-14-22(21)36-23/h7-10,12-15H,3-6,11,16-19,27H2,1-2H3/b10-7+,23-15- |
| InChIKey | QESQXMYHPGHUEM-DXDRQYPZSA-N |
| XLogP | 3.21 |
| TPSA | 139.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|