C18H17N3O6S2 — CID 6478379
3-[(2E)-2-[(E)-4-(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid (PubChem CID 6478379) has the molecular formula C18H17N3O6S2 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-4-(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2E)-2-[(E)-4-(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 6478379 |
| Molecular Formula | C18H17N3O6S2 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 3-[(2E)-2-[(E)-4-(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)but-2-enylidene]-1,3-benzoxazol-3-yl]propane-1-sulfonic acid |
| SMILES | O=C1NC(=S)NC(=O)C1=C/C=C/C=C1/Oc2ccccc2N1CCCS(=O)(=O)O |
| InChI | InChI=1S/C18H17N3O6S2/c22-16-12(17(23)20-18(28)19-16)6-1-4-9-15-21(10-5-11-29(24,25)26)13-7-2-3-8-14(13)27-15/h1-4,6-9H,5,10-11H2,(H,24,25,26)(H2,19,20,22,23,28)/b4-1+,15-9+ |
| InChIKey | MKULAWCRIVPTGL-XUNUSPGDSA-N |
| XLogP | 1.02 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|