C22H22N2O4S2 — CID 140595496
2-[2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-1,3-benzoxazol-3-yl]ethanesulfonate (PubChem CID 140595496) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-1,3-benzoxazol-3-yl]ethanesulfonate.
| Compound Name | 2-[2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-1,3-benzoxazol-3-yl]ethanesulfonate |
|---|---|
| PubChem CID | 140595496 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 2-[2-[3-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-1,3-benzoxazol-3-yl]ethanesulfonate |
| SMILES | CC[n+]1c(C=C(C)C=C2Oc3ccccc3N2CCS(=O)(=O)[O-])sc2ccccc21 |
| InChI | InChI=1S/C22H22N2O4S2/c1-3-23-18-9-5-7-11-20(18)29-22(23)15-16(2)14-21-24(12-13-30(25,26)27)17-8-4-6-10-19(17)28-21/h4-11,14-15H,3,12-13H2,1-2H3 |
| InChIKey | PISLEGDOBMZVOF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|