C30H31ClN2O5S — CID 73242382
3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-5-phenyl-1,3-benzoxazole perchlorate (PubChem CID 73242382) has the molecular formula C30H31ClN2O5S and a molecular weight of 567.11 g/mol. Its IUPAC name is 3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-5-phenyl-1,3-benzoxazole perchlorate.
| Compound Name | 3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-5-phenyl-1,3-benzoxazole perchlorate |
|---|---|
| PubChem CID | 73242382 |
| Molecular Formula | C30H31ClN2O5S |
| Molecular Weight | 567.11 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-5-phenyl-1,3-benzoxazole perchlorate |
| SMILES | CCN1C(=CC(C)=Cc2sc3cc(C)c(C)cc3[n+]2CC)Oc2ccc(-c3ccccc3)cc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C30H31N2OS.ClHO4/c1-6-31-25-19-24(23-11-9-8-10-12-23)13-14-27(25)33-29(31)15-20(3)16-30-32(7-2)26-17-21(4)22(5)18-28(26)34-30;2-1(3,4)5/h8-19H,6-7H2,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | YTGCTKQPCOIIPI-UHFFFAOYSA-M |
| XLogP | 2.90 |
| TPSA | 108.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.11 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|