C30H31N2OS+ — CID 2305177
3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-5-phenyl-1,3-benzoxazole (PubChem CID 2305177) has the molecular formula C30H31N2OS+ and a molecular weight of 467.66 g/mol. Its IUPAC name is 3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-5-phenyl-1,3-benzoxazole.
| Compound Name | 3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-5-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 2305177 |
| Molecular Formula | C30H31N2OS+ |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 3-ethyl-2-[3-(3-ethyl-5,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-2-methylprop-2-enylidene]-5-phenyl-1,3-benzoxazole |
| SMILES | CCN1C(=CC(C)=Cc2sc3cc(C)c(C)cc3[n+]2CC)Oc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C30H31N2OS/c1-6-31-25-19-24(23-11-9-8-10-12-23)13-14-27(25)33-29(31)15-20(3)16-30-32(7-2)26-17-21(4)22(5)18-28(26)34-30/h8-19H,6-7H2,1-5H3/q+1 |
| InChIKey | RJDHZEMECTVYFQ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|