C23H20N2O — CID 57270516
2-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)-1-phenylethanimine (PubChem CID 57270516) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)-1-phenylethanimine.
| Compound Name | 2-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)-1-phenylethanimine |
|---|---|
| PubChem CID | 57270516 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)-1-phenylethanimine |
| SMILES | [H]/N=C(/C=C1Oc2ccc(-c3ccccc3)cc2N1CC)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O/c1-2-25-21-15-19(17-9-5-3-6-10-17)13-14-22(21)26-23(25)16-20(24)18-11-7-4-8-12-18/h3-16,24H,2H2,1H3/b23-16?,24-20- |
| InChIKey | FCJBQOJOHYTXQO-JEYSLKMWSA-N |
| XLogP | 5.48 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|