C34H33IN2O2S — CID 88818921
3-ethyl-2-[2-[(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]-5-phenyl-2H-thiopyrano[2,3-d][1,3]oxazol-3-ium iodide (PubChem CID 88818921) has the molecular formula C34H33IN2O2S and a molecular weight of 660.62 g/mol. Its IUPAC name is 3-ethyl-2-[2-[(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]-5-phenyl-2H-thiopyrano[2,3-d][1,3]oxazol-3-ium iodide.
| Compound Name | 3-ethyl-2-[2-[(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]-5-phenyl-2H-thiopyrano[2,3-d][1,3]oxazol-3-ium iodide |
|---|---|
| PubChem CID | 88818921 |
| Molecular Formula | C34H33IN2O2S |
| Molecular Weight | 660.62 g/mol |
| Exact Mass | 660.13 |
| IUPAC Name | 3-ethyl-2-[2-[(3-ethyl-5-phenyl-1,3-benzoxazol-2-ylidene)methyl]but-1-enyl]-5-phenyl-2H-thiopyrano[2,3-d][1,3]oxazol-3-ium iodide |
| SMILES | CCC(=CC1OC2=CC=C(c3ccccc3)SC2=[N+]1CC)C=C1Oc2ccc(-c3ccccc3)cc2N1CC.[I-] |
| InChI | InChI=1S/C34H33N2O2S.HI/c1-4-24(21-32-35(5-2)28-23-27(17-18-29(28)37-32)25-13-9-7-10-14-25)22-33-36(6-3)34-30(38-33)19-20-31(39-34)26-15-11-8-12-16-26;/h7-23,33H,4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XCYJRCYTGRKDQD-UHFFFAOYSA-M |
| XLogP | 5.21 |
| TPSA | 24.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|