C23H22N2O7S3-2 — CID 59937728
2-[(5E)-5-[5,5-dimethyl-3-[[3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]methyl]cyclohex-2-en-1-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 59937728) has the molecular formula C23H22N2O7S3-2 and a molecular weight of 534.64 g/mol. Its IUPAC name is 2-[(5E)-5-[5,5-dimethyl-3-[[3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]methyl]cyclohex-2-en-1-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | 2-[(5E)-5-[5,5-dimethyl-3-[[3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]methyl]cyclohex-2-en-1-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 59937728 |
| Molecular Formula | C23H22N2O7S3-2 |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 2-[(5E)-5-[5,5-dimethyl-3-[[3-(2-sulfonatoethyl)-1,3-benzoxazol-2-ylidene]methyl]cyclohex-2-en-1-ylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | CC1(C)CC(C=C2Oc3ccccc3N2CCS(=O)(=O)[O-])=C/C(=C2/SC(=S)N(CC(=O)[O-])C2=O)C1 |
| InChI | InChI=1S/C23H24N2O7S3/c1-23(2)11-14(9-15(12-23)20-21(28)25(13-19(26)27)22(33)34-20)10-18-24(7-8-35(29,30)31)16-5-3-4-6-17(16)32-18/h3-6,9-10H,7-8,11-13H2,1-2H3,(H,26,27)(H,29,30,31)/p-2/b18-10?,20-15- |
| InChIKey | NNAQNDWUPODNHH-DIQOLWJISA-L |
| XLogP | 1.88 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|