C25H24N2OS3 — CID 3905455
3-ethyl-5-[2-[3-ethyl-6-(2-phenylethenyl)-1,3-benzothiazol-2-ylidene]propylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3905455) has the molecular formula C25H24N2OS3 and a molecular weight of 464.68 g/mol. Its IUPAC name is 3-ethyl-5-[2-[3-ethyl-6-(2-phenylethenyl)-1,3-benzothiazol-2-ylidene]propylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-ethyl-5-[2-[3-ethyl-6-(2-phenylethenyl)-1,3-benzothiazol-2-ylidene]propylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3905455 |
| Molecular Formula | C25H24N2OS3 |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-ethyl-5-[2-[3-ethyl-6-(2-phenylethenyl)-1,3-benzothiazol-2-ylidene]propylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)C(=CC(C)=C2Sc3cc(C=Cc4ccccc4)ccc3N2CC)SC1=S |
| InChI | InChI=1S/C25H24N2OS3/c1-4-26-20-14-13-19(12-11-18-9-7-6-8-10-18)16-21(20)30-24(26)17(3)15-22-23(28)27(5-2)25(29)31-22/h6-16H,4-5H2,1-3H3 |
| InChIKey | ZEPFYQAIMCKRNB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|