C26H19NO3S — CID 91745141
(4Z)-4-[(2Z)-2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]isochromene-1,3-dione (PubChem CID 91745141) has the molecular formula C26H19NO3S and a molecular weight of 425.51 g/mol. Its IUPAC name is (4Z)-4-[(2Z)-2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]isochromene-1,3-dione.
| Compound Name | (4Z)-4-[(2Z)-2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]isochromene-1,3-dione |
|---|---|
| PubChem CID | 91745141 |
| Molecular Formula | C26H19NO3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (4Z)-4-[(2Z)-2-(3-ethyl-5-phenyl-1,3-benzothiazol-2-ylidene)ethylidene]isochromene-1,3-dione |
| SMILES | CCN1/C(=C/C=C2\C(=O)OC(=O)c3ccccc32)Sc2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C26H19NO3S/c1-2-27-22-16-18(17-8-4-3-5-9-17)12-14-23(22)31-24(27)15-13-21-19-10-6-7-11-20(19)25(28)30-26(21)29/h3-16H,2H2,1H3/b21-13-,24-15- |
| InChIKey | JXTYLQNVXMLZHA-ZZWPXBBISA-N |
| XLogP | 5.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|